Products 111682-58-7
CAS 111682-58-7 is the registry number for Metronidazole phosphate (disodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;2-(2-methyl-5-nitroimidazol-1-yl)ethyl phosphate (CAS 111682-58-7) is a chemical compound with the molecular formula C6H8N3Na2O6P and a molecular weight of 295.10 g/mol. IUPAC name: disodium;2-(2-methyl-5-nitroimidazol-1-yl)ethyl phosphate. InChIKey: QXYURHOEFCEYLH-UHFFFAOYSA-L.
| Molecular formula | C6H8N3Na2O6P |
|---|---|
| Molecular weight | 295.10 g/mol |
| IUPAC name | disodium;2-(2-methyl-5-nitroimidazol-1-yl)ethyl phosphate |
| InChIKey | QXYURHOEFCEYLH-UHFFFAOYSA-L |
| SMILES | CC1=NC=C(N1CCOP(=O)([O-])[O-])[N+](=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)