CAS 111691-92-0 appears in our catalog under these names: 2-Acetamido-4-methoxy-4-oxobutanoic acid, 95%, 2-Acetamido-4-methoxy-4-oxobutanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-acetamido-4-methoxy-4-oxobutanoate (CAS 111691-92-0) is a chemical compound with the molecular formula C7H10NO5- and a molecular weight of 188.16 g/mol. IUPAC name: 2-acetamido-4-methoxy-4-oxobutanoate. InChIKey: ZDPZXMGPKKVZGD-UHFFFAOYSA-M.
| Molecular formula | C7H10NO5- |
|---|---|
| Molecular weight | 188.16 g/mol |
| IUPAC name | 2-acetamido-4-methoxy-4-oxobutanoate |
| InChIKey | ZDPZXMGPKKVZGD-UHFFFAOYSA-M |
| SMILES | CC(=O)NC(CC(=O)OC)C(=O)[O-] |
Computed by PubChem (NCBI)