Products 111787-82-7

CAS 111787-82-7 is the registry number for Ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate (CAS 111787-82-7) is a chemical compound with the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. IUPAC name: ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate. InChIKey: FQMARORYZJGMIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15ClO4
Molecular weight282.72 g/mol
IUPAC nameethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate
InChIKeyFQMARORYZJGMIZ-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC(=O)C1=CC=C(C=C1)Cl)C(=O)C

Computed by PubChem (NCBI)