CAS 111787-82-7 is the registry number for Ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate (CAS 111787-82-7) is a chemical compound with the molecular formula C14H15ClO4 and a molecular weight of 282.72 g/mol. IUPAC name: ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate. InChIKey: FQMARORYZJGMIZ-UHFFFAOYSA-N.
| Molecular formula | C14H15ClO4 |
|---|---|
| Molecular weight | 282.72 g/mol |
| IUPAC name | ethyl 2-acetyl-4-(4-chlorophenyl)-4-oxobutanoate |
| InChIKey | FQMARORYZJGMIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC(=O)C1=CC=C(C=C1)Cl)C(=O)C |
Computed by PubChem (NCBI)