CAS 111854-71-8 is the registry number for 4-(((2,4-Diaminopteridin-6-yl)methyl)(prop-2-yn-1-yl)amino)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]benzoic acid (CAS 111854-71-8) is a chemical compound with the molecular formula C17H15N7O2 and a molecular weight of 349.3 g/mol. IUPAC name: 4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]benzoic acid. InChIKey: KIDSKNXGLXJKPI-UHFFFAOYSA-N.
| Molecular formula | C17H15N7O2 |
|---|---|
| Molecular weight | 349.3 g/mol |
| IUPAC name | 4-[(2,4-diaminopteridin-6-yl)methyl-prop-2-ynylamino]benzoic acid |
| InChIKey | KIDSKNXGLXJKPI-UHFFFAOYSA-N |
| SMILES | C#CCN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)