Products 111883-10-4
CAS 111883-10-4 is the registry number for Rhodamine B thiolactone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3',6'-bis(diethylamino)spiro[2-benzothiophene-3,9'-xanthene]-1-one (CAS 111883-10-4) is a chemical compound with the molecular formula C28H30N2O2S and a molecular weight of 458.6 g/mol. IUPAC name: 3',6'-bis(diethylamino)spiro[2-benzothiophene-3,9'-xanthene]-1-one. InChIKey: AAQKETQXOGXQRO-UHFFFAOYSA-N.
| Molecular formula | C28H30N2O2S |
|---|---|
| Molecular weight | 458.6 g/mol |
| IUPAC name | 3',6'-bis(diethylamino)spiro[2-benzothiophene-3,9'-xanthene]-1-one |
| InChIKey | AAQKETQXOGXQRO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)S3 |
Computed by PubChem (NCBI)
Synonyms:
Rhodamine B thiolactone, orb2565356