Products 1118849-23-2
CAS 1118849-23-2 is the registry number for (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 4-acetyl-1H-pyrrole-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 4-acetyl-1H-pyrrole-2-carboxylate (CAS 1118849-23-2) is a chemical compound with the molecular formula C15H12ClN3O3 and a molecular weight of 317.72 g/mol. IUPAC name: (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 4-acetyl-1H-pyrrole-2-carboxylate. InChIKey: VZVMXTFKJVNNDO-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O3 |
|---|---|
| Molecular weight | 317.72 g/mol |
| IUPAC name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 4-acetyl-1H-pyrrole-2-carboxylate |
| InChIKey | VZVMXTFKJVNNDO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CNC(=C1)C(=O)OCC2=CN3C=C(C=CC3=N2)Cl |
Computed by PubChem (NCBI)