CAS 111896-77-6 appears in our catalog under these names: 4-Chloro-5,6,7,8-tetrahydroquinazolin-2-amine, 95%, 4-Chloro-5,6,7,8-tetrahydroquinazolin-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 2,5g, 250mg.
4-chloro-5,6,7,8-tetrahydroquinazolin-2-amine (CAS 111896-77-6) is a chemical compound with the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. IUPAC name: 4-chloro-5,6,7,8-tetrahydroquinazolin-2-amine. InChIKey: BTLNLOHFQGIGLV-UHFFFAOYSA-N.
| Molecular formula | C8H10ClN3 |
|---|---|
| Molecular weight | 183.64 g/mol |
| IUPAC name | 4-chloro-5,6,7,8-tetrahydroquinazolin-2-amine |
| InChIKey | BTLNLOHFQGIGLV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)