CAS 111928-07-5 appears in our catalog under these names: Tetraethylphosphonium hexafluorophosphate, 95%, Tetraethylphosphonium hexafluorophosphate(V), Tetraethylphosphonium Hexafluorophosphate, >99.0%(T), Tetraethylphosphonium Hexafluorophosphate, Tetraethylphosphonium hexafluorophosphate, 99%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg.
Tetraethylphosphanium hexafluorophosphate (CAS 111928-07-5) is a chemical compound with the molecular formula C8H20F6P2 and a molecular weight of 292.18 g/mol. IUPAC name: tetraethylphosphanium hexafluorophosphate. InChIKey: WJZBUQKNTCKXAE-UHFFFAOYSA-N.
| Molecular formula | C8H20F6P2 |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | tetraethylphosphanium hexafluorophosphate |
| InChIKey | WJZBUQKNTCKXAE-UHFFFAOYSA-N |
| SMILES | CC[P+](CC)(CC)CC.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)