CAS 1119449-39-6 is the registry number for 5-(4-Bromophenyl)-2-chloropyridine-3-carboxaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(4-bromophenyl)-2-chloropyridine-3-carbaldehyde (CAS 1119449-39-6) is a chemical compound with the molecular formula C12H7BrClNO and a molecular weight of 296.54 g/mol. IUPAC name: 5-(4-bromophenyl)-2-chloropyridine-3-carbaldehyde. InChIKey: ONLSOUWWZPSWCK-UHFFFAOYSA-N.
| Molecular formula | C12H7BrClNO |
|---|---|
| Molecular weight | 296.54 g/mol |
| IUPAC name | 5-(4-bromophenyl)-2-chloropyridine-3-carbaldehyde |
| InChIKey | ONLSOUWWZPSWCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(N=C2)Cl)C=O)Br |
Computed by PubChem (NCBI)