CAS 1119451-07-8 is the registry number for Methyl ([2-chloro-4-(trifluoromethyl)phenyl]thio)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-[2-chloro-4-(trifluoromethyl)phenyl]sulfanylacetate (CAS 1119451-07-8) is a chemical compound with the molecular formula C10H8ClF3O2S and a molecular weight of 284.68 g/mol. IUPAC name: methyl 2-[2-chloro-4-(trifluoromethyl)phenyl]sulfanylacetate. InChIKey: YAFRLGRUPRZXAM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O2S |
|---|---|
| Molecular weight | 284.68 g/mol |
| IUPAC name | methyl 2-[2-chloro-4-(trifluoromethyl)phenyl]sulfanylacetate |
| InChIKey | YAFRLGRUPRZXAM-UHFFFAOYSA-N |
| SMILES | COC(=O)CSC1=C(C=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)