CAS 1119452-83-3 is the registry number for 2-Bromo-n-(3,4-dimethoxyphenyl)propanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-(3,4-dimethoxyphenyl)propanamide (CAS 1119452-83-3) is a chemical compound with the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. IUPAC name: 2-bromo-N-(3,4-dimethoxyphenyl)propanamide. InChIKey: QELKSBIJCLTLSB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO3 |
|---|---|
| Molecular weight | 288.14 g/mol |
| IUPAC name | 2-bromo-N-(3,4-dimethoxyphenyl)propanamide |
| InChIKey | QELKSBIJCLTLSB-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC(=C(C=C1)OC)OC)Br |
Computed by PubChem (NCBI)