CAS 1119489-35-8 appears in our catalog under these names: 1-(3-Fluorophenyl)-5-(trifluoromethyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(3-Fluorophenyl)-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic Acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 1119489-35-8) is a chemical compound with the molecular formula C11H6F4N2O2 and a molecular weight of 274.17 g/mol. IUPAC name: 1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: DQFNNZACWHABEG-UHFFFAOYSA-N.
| Molecular formula | C11H6F4N2O2 |
|---|---|
| Molecular weight | 274.17 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-5-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | DQFNNZACWHABEG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C(=C(C=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)