CAS 111974-74-4 appears in our catalog under these names: Quetiapine Impurity B (EP) DiHCl, Quetiapine EP Impurity B DiHCl, N-Des(2-(2-hydroxyethoxy)ethyl) Quetiapine Dihydrochloride, >95% (HPLC), N-Des(2-(2-hydroxyethoxy)ethyl) Quetiapine Dihydrochloride (1.0 mg/mL in Methanol), 11-(Piperazin-1-yl)dibenzo(b,f)(1,4)thiazepine Dihydrochloride. Offered by: Chemat Brand, TRC, Mikromol, Lipomed, Biosynth. Available pack sizes: on request, 1g, 25g, 5g, 10x1ml, 4x25mg, 25mg, 100mg.
6-piperazin-1-ylbenzo[b][1,4]benzothiazepine;dihydrochloride (CAS 111974-74-4) is a chemical compound with the molecular formula C17H19Cl2N3S and a molecular weight of 368.3 g/mol. IUPAC name: 6-piperazin-1-ylbenzo[b][1,4]benzothiazepine;dihydrochloride. InChIKey: PZQCQHZDUIIKFU-UHFFFAOYSA-N.
| Molecular formula | C17H19Cl2N3S |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 6-piperazin-1-ylbenzo[b][1,4]benzothiazepine;dihydrochloride |
| InChIKey | PZQCQHZDUIIKFU-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=CC=CC=C3SC4=CC=CC=C42.Cl.Cl |
Computed by PubChem (NCBI)