Products 1119807-02-1
CAS 1119807-02-1 is the registry number for AZD5213. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1S,2S)-2-(4-cyclobutylpiperazine-1-carbonyl)cyclopropyl]benzamide (CAS 1119807-02-1) is a chemical compound with the molecular formula C19H25N3O2 and a molecular weight of 327.4 g/mol. IUPAC name: 4-[(1S,2S)-2-(4-cyclobutylpiperazine-1-carbonyl)cyclopropyl]benzamide. InChIKey: VCQZCDSEWSFTPO-SJORKVTESA-N.
| Molecular formula | C19H25N3O2 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-[(1S,2S)-2-(4-cyclobutylpiperazine-1-carbonyl)cyclopropyl]benzamide |
| InChIKey | VCQZCDSEWSFTPO-SJORKVTESA-N |
| SMILES | C1CC(C1)N2CCN(CC2)C(=O)[C@H]3C[C@@H]3C4=CC=C(C=C4)C(=O)N |
Computed by PubChem (NCBI)