CAS 1119899-37-4 appears in our catalog under these names: 7-Cyanobenzo[b]thiophen-2-ylboronic acid, 95%, (7-Cyanobenzo(b)thiophen-2-yl)boronic acid, 98+%, (7-CYANOBENZO[B]THIOPHEN-2-YL)BORONIC ACID, 95%, 95%, (7-Cyanobenzo[b]thiophen-2-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(7-cyano-1-benzothiophen-2-yl)boronic acid (CAS 1119899-37-4) is a chemical compound with the molecular formula C9H6BNO2S and a molecular weight of 203.03 g/mol. IUPAC name: (7-cyano-1-benzothiophen-2-yl)boronic acid. InChIKey: AKOHCYHBCAFLGM-UHFFFAOYSA-N.
| Molecular formula | C9H6BNO2S |
|---|---|
| Molecular weight | 203.03 g/mol |
| IUPAC name | (7-cyano-1-benzothiophen-2-yl)boronic acid |
| InChIKey | AKOHCYHBCAFLGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)C(=CC=C2)C#N)(O)O |
Computed by PubChem (NCBI)