Products 111992-05-3
CAS 111992-05-3 is the registry number for Chloro Fluoro Triazolin-3-one. Offered by: TRC. Available pack sizes: 100mg.
2-(4-chloro-2-fluorophenyl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one (CAS 111992-05-3) is a chemical compound with the molecular formula C10H7ClF3N3O and a molecular weight of 277.63 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenyl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one. InChIKey: WPCDJTIPGVMACI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClF3N3O |
|---|---|
| Molecular weight | 277.63 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenyl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one |
| InChIKey | WPCDJTIPGVMACI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)N1C(F)F)C2=C(C=C(C=C2)Cl)F |
Computed by PubChem (NCBI)
Synonyms:
Chloro Fluoro Triazolin-3-one