CAS 111992-16-6 is the registry number for 2-(2,4-Dichlorophenyl)-4-(difluoromethyl)-2,4-dihydro-5-methyl-3H-1,2,4-triazol-3-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,4-dichlorophenyl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one (CAS 111992-16-6) is a chemical compound with the molecular formula C10H7Cl2F2N3O and a molecular weight of 294.08 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one. InChIKey: XNMSYRWOPSLMRJ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2F2N3O |
|---|---|
| Molecular weight | 294.08 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-4-(difluoromethyl)-5-methyl-1,2,4-triazol-3-one |
| InChIKey | XNMSYRWOPSLMRJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)N1C(F)F)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)