CAS 112-77-6 appears in our catalog under these names: Oleoyl chloride, tech grade, >=90% tech. grade, Oleoyl Chloride, Oleoyl Chloride, >80.0%(GC), Oleoyl Chloride 80%, OLEOYL CHLORIDE, >=89%. Offered by: Combi-blocks, TRC, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 500mg, 500g, 1000g, 250g.
(Z)-octadec-9-enoyl chloride (CAS 112-77-6) is a chemical compound with the molecular formula C18H33ClO and a molecular weight of 300.9 g/mol. IUPAC name: (Z)-octadec-9-enoyl chloride. InChIKey: MLQBTMWHIOYKKC-KTKRTIGZSA-N.
| Molecular formula | C18H33ClO |
|---|---|
| Molecular weight | 300.9 g/mol |
| IUPAC name | (Z)-octadec-9-enoyl chloride |
| InChIKey | MLQBTMWHIOYKKC-KTKRTIGZSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)Cl |
Computed by PubChem (NCBI)