Products 1120360-13-5
CAS 1120360-13-5 appears in our catalog under these names: Glyceryl ascorbate, 95%, Glyceryl Ascorbate, Glyceryl Ascorbate, >95.0%(T)(HPLC), Glyceryl Ascorbate. Offered by: Combi-blocks, GLPBio, TCI, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 5g, Get quote.
(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-(2,3-dihydroxypropoxy)-3-hydroxy-2H-furan-5-one (CAS 1120360-13-5) is a chemical compound with the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. IUPAC name: (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-(2,3-dihydroxypropoxy)-3-hydroxy-2H-furan-5-one. InChIKey: KQWQJCDIYBPYNT-ACFLWUFDSA-N.
| Molecular formula | C9H14O8 |
|---|---|
| Molecular weight | 250.20 g/mol |
| IUPAC name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-4-(2,3-dihydroxypropoxy)-3-hydroxy-2H-furan-5-one |
| InChIKey | KQWQJCDIYBPYNT-ACFLWUFDSA-N |
| SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)OCC(CO)O)O)O)O |
Computed by PubChem (NCBI)