CAS 1120364-53-5 appears in our catalog under these names: 2'-Azidoethyl 2-bromoisobutyrate, 97%, Br–Boc–C2–azido, 2-Azidoethyl 2-bromoisobutyrate, >=95%, 2-Azidoethyl 2-bromo-2-methylpropanoate, 98%, 98%, Br-Boc-C2-azido. Offered by: Combi-blocks, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 100mg, 1 g, 100 mg.
2-azidoethyl 2-bromo-2-methylpropanoate (CAS 1120364-53-5) is a chemical compound with the molecular formula C6H10BrN3O2 and a molecular weight of 236.07 g/mol. IUPAC name: 2-azidoethyl 2-bromo-2-methylpropanoate. InChIKey: OYSXPOJKJKBNSG-UHFFFAOYSA-N.
| Molecular formula | C6H10BrN3O2 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-azidoethyl 2-bromo-2-methylpropanoate |
| InChIKey | OYSXPOJKJKBNSG-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OCCN=[N+]=[N-])Br |
Computed by PubChem (NCBI)