Products 112109-69-0
CAS 112109-69-0 appears in our catalog under these names: 4-Hydroxy-2,3,5-trimethylphenyl pivalate, 98%, 1-Pivaloyl-2,3,5-trimethylhydroquinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g, 2g, 500mg.
(4-hydroxy-2,3,5-trimethylphenyl) 2,2-dimethylpropanoate (CAS 112109-69-0) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: (4-hydroxy-2,3,5-trimethylphenyl) 2,2-dimethylpropanoate. InChIKey: UFMQDNRRAHRPCN-UHFFFAOYSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | (4-hydroxy-2,3,5-trimethylphenyl) 2,2-dimethylpropanoate |
| InChIKey | UFMQDNRRAHRPCN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1O)C)C)OC(=O)C(C)(C)C |
Computed by PubChem (NCBI)