Products 1121596-44-8

CAS 1121596-44-8 is the registry number for 1-(4-Boc-Piperazino)-3,5-dibromobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(3,5-dibromophenyl)piperazine-1-carboxylate (CAS 1121596-44-8) is a chemical compound with the molecular formula C15H20Br2N2O2 and a molecular weight of 420.14 g/mol. IUPAC name: tert-butyl 4-(3,5-dibromophenyl)piperazine-1-carboxylate. InChIKey: LUTCSDRKBGOXGM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H20Br2N2O2
Molecular weight420.14 g/mol
IUPAC nametert-butyl 4-(3,5-dibromophenyl)piperazine-1-carboxylate
InChIKeyLUTCSDRKBGOXGM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=CC(=C2)Br)Br

Computed by PubChem (NCBI)