Products 112160-39-1

CAS 112160-39-1 appears in our catalog under these names: 2,2,5,7,8-Pentamethylchroman-6-sulfonyl chloride, 95%, Pmc-Cl 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.

Structural formula: {0} (CAS {1})

2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonyl chloride (CAS 112160-39-1) is a chemical compound with the molecular formula C14H19ClO3S and a molecular weight of 302.8 g/mol. IUPAC name: 2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonyl chloride. InChIKey: UXUOVYKDMGFUDU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19ClO3S
Molecular weight302.8 g/mol
IUPAC name2,2,5,7,8-pentamethyl-3,4-dihydrochromene-6-sulfonyl chloride
InChIKeyUXUOVYKDMGFUDU-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C2=C1OC(CC2)(C)C)C)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)