CAS 1121610-24-9 is the registry number for 1-(3,5-Dibromophenyl)piperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-(3,5-dibromophenyl)piperazine (CAS 1121610-24-9) is a chemical compound with the molecular formula C10H12Br2N2 and a molecular weight of 320.02 g/mol. IUPAC name: 1-(3,5-dibromophenyl)piperazine. InChIKey: LBCMQRUBXURELD-UHFFFAOYSA-N.
| Molecular formula | C10H12Br2N2 |
|---|---|
| Molecular weight | 320.02 g/mol |
| IUPAC name | 1-(3,5-dibromophenyl)piperazine |
| InChIKey | LBCMQRUBXURELD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)