CAS 112251-56-6 appears in our catalog under these names: Demethylamino Ranitidine Acetamide Sodium, Ranitidine EP Impurity D (as Sodium Salt), Demethylamino Ranitidine Acetamide Sodium, N-(2-(((5-((Dimethylamino)methyl)-2-furanyl)methyl)thio)ethyl)-2-nitroacetamide sodium salt, Demethylamino Ranitidine Acetamide Sodium, ≥97%, ≥97%. Offered by: TRC, Mikromol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 1mg, 25mg, 50mg, 5mg, 250mg, 1000mg.
Sodium (Z)-1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenolate (CAS 112251-56-6) is a chemical compound with the molecular formula C12H18N3NaO4S and a molecular weight of 323.35 g/mol. IUPAC name: sodium (Z)-1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenolate. InChIKey: YWETXBRGXAEYGG-JCTPKUEWSA-M.
| Molecular formula | C12H18N3NaO4S |
|---|---|
| Molecular weight | 323.35 g/mol |
| IUPAC name | sodium (Z)-1-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylamino]-2-nitroethenolate |
| InChIKey | YWETXBRGXAEYGG-JCTPKUEWSA-M |
| SMILES | CN(C)CC1=CC=C(O1)CSCCN/C(=C/[N+](=O)[O-])/[O-].[Na+] |
Computed by PubChem (NCBI)