CAS 112274-95-0 is the registry number for Mesitylene-13C3. Offered by: TRC. Available pack sizes: 25mg.
1,3,5-tri((113C)methyl)benzene (CAS 112274-95-0) is a chemical compound with the molecular formula C9H12 and a molecular weight of 123.17 g/mol. IUPAC name: 1,3,5-tri((113C)methyl)benzene. InChIKey: AUHZEENZYGFFBQ-VMIGTVKRSA-N.
| Molecular formula | C9H12 |
|---|---|
| Molecular weight | 123.17 g/mol |
| IUPAC name | 1,3,5-tri((113C)methyl)benzene |
| InChIKey | AUHZEENZYGFFBQ-VMIGTVKRSA-N |
| SMILES | [13CH3]C1=CC(=CC(=C1)[13CH3])[13CH3] |
Computed by PubChem (NCBI)