CAS 1123-49-5 appears in our catalog under these names: 3,5–Dimethyl–4–nitroisoxazole, 3,5-Dimethyl-4-nitroisoxazole 97%, 3,5-Dimethyl-4-nitroisoxazole, 97%, 97%, 3,5-Dimethyl-4-nitroisoxazole, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g, 500g, 10g.
3,5-dimethyl-4-nitro-1,2-oxazole (CAS 1123-49-5) is a chemical compound with the molecular formula C5H6N2O3 and a molecular weight of 142.11 g/mol. IUPAC name: 3,5-dimethyl-4-nitro-1,2-oxazole. InChIKey: PMQFLWLYAXYFHG-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O3 |
|---|---|
| Molecular weight | 142.11 g/mol |
| IUPAC name | 3,5-dimethyl-4-nitro-1,2-oxazole |
| InChIKey | PMQFLWLYAXYFHG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)