CAS 112346-92-6 appears in our catalog under these names: DL-Norepinephrine 3-sulfate, DL-Norepinephrine 3-Sulfate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1mg, 5mg.
[5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] hydrogen sulfate (CAS 112346-92-6) is a chemical compound with the molecular formula C8H11NO6S and a molecular weight of 249.24 g/mol. IUPAC name: [5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] hydrogen sulfate. InChIKey: AXVWGBSBINEIHZ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO6S |
|---|---|
| Molecular weight | 249.24 g/mol |
| IUPAC name | [5-(2-amino-1-hydroxyethyl)-2-hydroxyphenyl] hydrogen sulfate |
| InChIKey | AXVWGBSBINEIHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CN)O)OS(=O)(=O)O)O |
Computed by PubChem (NCBI)