CAS 112393-65-4 appears in our catalog under these names: Triazolam-d3 (1.0mg/ml in Acetonitrile), Triazolam-d3, >95% (HPLC), Triazolam-D3. Offered by: TRC, Biosynth. Available pack sizes: 5x1ml, 50mg, 5mg, 1mg, 10mg.
8-chloro-6-(2-chlorophenyl)-1-(trideuteriomethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine (CAS 112393-65-4) is a chemical compound with the molecular formula C17H12Cl2N4 and a molecular weight of 346.2 g/mol. IUPAC name: 8-chloro-6-(2-chlorophenyl)-1-(trideuteriomethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine. InChIKey: JOFWLTCLBGQGBO-FIBGUPNXSA-N.
| Molecular formula | C17H12Cl2N4 |
|---|---|
| Molecular weight | 346.2 g/mol |
| IUPAC name | 8-chloro-6-(2-chlorophenyl)-1-(trideuteriomethyl)-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepine |
| InChIKey | JOFWLTCLBGQGBO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=NC2)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)