Products 1124199-21-8

CAS 1124199-21-8 is the registry number for tert-Butyl N-methyl-N-{((3R)-piperidin-3-yl)methyl}carbamate, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g, 1g.

Tert-butyl N-methyl-N-[[(3R)-piperidin-3-yl]methyl]carbamate (CAS 1124199-21-8) is a chemical compound with the molecular formula C12H24N2O2 and a molecular weight of 228.33 g/mol. IUPAC name: tert-butyl N-methyl-N-[[(3R)-piperidin-3-yl]methyl]carbamate. InChIKey: HQZPRFQKDGVCLB-SNVBAGLBSA-N.

Identity
Molecular formulaC12H24N2O2
Molecular weight228.33 g/mol
IUPAC nametert-butyl N-methyl-N-[[(3R)-piperidin-3-yl]methyl]carbamate
InChIKeyHQZPRFQKDGVCLB-SNVBAGLBSA-N
SMILESCC(C)(C)OC(=O)N(C)C[C@@H]1CCCNC1

Computed by PubChem (NCBI)