CAS 1125-52-6 is the registry number for 1-Bromo-2,3,4,5-tetrachlorobenzene. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
1-bromo-2,3,4,5-tetrachlorobenzene (CAS 1125-52-6) is a chemical compound with the molecular formula C6HBrCl4 and a molecular weight of 294.8 g/mol. IUPAC name: 1-bromo-2,3,4,5-tetrachlorobenzene. InChIKey: NEPMWYGBQGFJHN-UHFFFAOYSA-N.
| Molecular formula | C6HBrCl4 |
|---|---|
| Molecular weight | 294.8 g/mol |
| IUPAC name | 1-bromo-2,3,4,5-tetrachlorobenzene |
| InChIKey | NEPMWYGBQGFJHN-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)