Products 1125409-87-1
CAS 1125409-87-1 is the registry number for 1-[4-(trifluoromethoxy)phenyl]guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(trifluoromethoxy)phenyl]guanidine (CAS 1125409-87-1) is a chemical compound with the molecular formula C8H8F3N3O and a molecular weight of 219.16 g/mol. IUPAC name: 2-[4-(trifluoromethoxy)phenyl]guanidine. InChIKey: RDOHBENOPULTBD-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N3O |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 2-[4-(trifluoromethoxy)phenyl]guanidine |
| InChIKey | RDOHBENOPULTBD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C(N)N)OC(F)(F)F |
Computed by PubChem (NCBI)