CAS 1125758-85-1 appears in our catalog under these names: S-2-Cyano-1-(1-phenylethyl)-3-(quinolin-5-yl)guanidine, 99%, 99%, A 804598, A-804598/ 100%, A 804598, A-804598 99%. Offered by: Chemat, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 500mg.
1-cyano-2-[(1S)-1-phenylethyl]-3-quinolin-5-ylguanidine (CAS 1125758-85-1) is a chemical compound with the molecular formula C19H17N5 and a molecular weight of 315.4 g/mol. IUPAC name: 1-cyano-2-[(1S)-1-phenylethyl]-3-quinolin-5-ylguanidine. InChIKey: PQYCRDPLPKGSME-AWEZNQCLSA-N.
| Molecular formula | C19H17N5 |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 1-cyano-2-[(1S)-1-phenylethyl]-3-quinolin-5-ylguanidine |
| InChIKey | PQYCRDPLPKGSME-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N=C(NC#N)NC2=CC=CC3=C2C=CC=N3 |
Computed by PubChem (NCBI)