Products 1126138-13-3
CAS 1126138-13-3 appears in our catalog under these names: 2,4,6-Trimethylbenzeneamine-d11, >95% (HPLC), 2,4,6-Trimethylbenzeneamine-d11. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
3,5-dideuterio-2,4,6-tris(trideuteriomethyl)aniline (CAS 1126138-13-3) is a chemical compound with the molecular formula C9H13N and a molecular weight of 146.27 g/mol. IUPAC name: 3,5-dideuterio-2,4,6-tris(trideuteriomethyl)aniline. InChIKey: KWVPRPSXBZNOHS-JXCHDVSKSA-N.
| Molecular formula | C9H13N |
|---|---|
| Molecular weight | 146.27 g/mol |
| IUPAC name | 3,5-dideuterio-2,4,6-tris(trideuteriomethyl)aniline |
| InChIKey | KWVPRPSXBZNOHS-JXCHDVSKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])N)C([2H])([2H])[2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)