CAS 112639-10-8 is the registry number for 4-Bromo-Cannabidiol. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol (CAS 112639-10-8) is a chemical compound with the molecular formula C21H29BrO2 and a molecular weight of 393.4 g/mol. IUPAC name: 4-bromo-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol. InChIKey: ZGLBJRARNUQZPX-DLBZAZTESA-N.
| Molecular formula | C21H29BrO2 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 4-bromo-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| InChIKey | ZGLBJRARNUQZPX-DLBZAZTESA-N |
| SMILES | CCCCCC1=CC(=C(C(=C1Br)O)[C@@H]2C=C(CC[C@H]2C(=C)C)C)O |
Computed by PubChem (NCBI)