CAS 1126602-42-3 is the registry number for AG311. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(4-methylphenyl)sulfanyl-9H-pyrimido[4,5-b]indole-2,4-diamine (CAS 1126602-42-3) is a chemical compound with the molecular formula C17H15N5S and a molecular weight of 321.4 g/mol. IUPAC name: 5-(4-methylphenyl)sulfanyl-9H-pyrimido[4,5-b]indole-2,4-diamine. InChIKey: IMNBYLUXBBXZIY-UHFFFAOYSA-N.
| Molecular formula | C17H15N5S |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 5-(4-methylphenyl)sulfanyl-9H-pyrimido[4,5-b]indole-2,4-diamine |
| InChIKey | IMNBYLUXBBXZIY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)SC2=CC=CC3=C2C4=C(N=C(N=C4N3)N)N |
Computed by PubChem (NCBI)