CAS 1126635-06-0 is the registry number for 5-(2,3-Difluorophenyl)furan-2-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(2,3-difluorophenyl)furan-2-carbaldehyde (CAS 1126635-06-0) is a chemical compound with the molecular formula C11H6F2O2 and a molecular weight of 208.16 g/mol. IUPAC name: 5-(2,3-difluorophenyl)furan-2-carbaldehyde. InChIKey: QEWHDSVJGJKRPO-UHFFFAOYSA-N.
| Molecular formula | C11H6F2O2 |
|---|---|
| Molecular weight | 208.16 g/mol |
| IUPAC name | 5-(2,3-difluorophenyl)furan-2-carbaldehyde |
| InChIKey | QEWHDSVJGJKRPO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C2=CC=C(O2)C=O |
Computed by PubChem (NCBI)