CAS 1126636-60-9 is the registry number for Ethyl 5-(2-fluoro-4-methoxyphenyl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(2-fluoro-4-methoxyphenyl)-1,2-oxazole-3-carboxylate (CAS 1126636-60-9) is a chemical compound with the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. IUPAC name: ethyl 5-(2-fluoro-4-methoxyphenyl)-1,2-oxazole-3-carboxylate. InChIKey: OOBWOJJTALDCRF-UHFFFAOYSA-N.
| Molecular formula | C13H12FNO4 |
|---|---|
| Molecular weight | 265.24 g/mol |
| IUPAC name | ethyl 5-(2-fluoro-4-methoxyphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | OOBWOJJTALDCRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=C(C=C(C=C2)OC)F |
Computed by PubChem (NCBI)