CAS 1126637-40-8 is the registry number for 5-Chloro-2-(chloromethyl)-6-nitro-1,3-benzoxazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
5-chloro-2-(chloromethyl)-6-nitro-1,3-benzoxazole (CAS 1126637-40-8) is a chemical compound with the molecular formula C8H4Cl2N2O3 and a molecular weight of 247.03 g/mol. IUPAC name: 5-chloro-2-(chloromethyl)-6-nitro-1,3-benzoxazole. InChIKey: SRPKCXKSPUIWAV-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2O3 |
|---|---|
| Molecular weight | 247.03 g/mol |
| IUPAC name | 5-chloro-2-(chloromethyl)-6-nitro-1,3-benzoxazole |
| InChIKey | SRPKCXKSPUIWAV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)[N+](=O)[O-])OC(=N2)CCl |
Computed by PubChem (NCBI)