CAS 112674-65-4 appears in our catalog under these names: (S)-2-Acetamido-4,4-dimethylpentanoic acid, 95%, (S)–2–Acetamido–4,4–dimethylpentanoic acid, (S)-2-Acetamido-4,4-dimethylpentanoic acid, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
(2S)-2-acetamido-4,4-dimethylpentanoic acid (CAS 112674-65-4) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: (2S)-2-acetamido-4,4-dimethylpentanoic acid. InChIKey: DGGQDBMYIWFFHL-ZETCQYMHSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | (2S)-2-acetamido-4,4-dimethylpentanoic acid |
| InChIKey | DGGQDBMYIWFFHL-ZETCQYMHSA-N |
| SMILES | CC(=O)N[C@@H](CC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)