CAS 112677-16-4 is the registry number for 3-(Dimethylamino)-1-(2-thienyl)-2-buten-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-3-(dimethylamino)-1-thiophen-2-ylbut-2-en-1-one (CAS 112677-16-4) is a chemical compound with the molecular formula C10H13NOS and a molecular weight of 195.28 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-thiophen-2-ylbut-2-en-1-one. InChIKey: NXGSXJMLDZJGIZ-BQYQJAHWSA-N.
| Molecular formula | C10H13NOS |
|---|---|
| Molecular weight | 195.28 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-thiophen-2-ylbut-2-en-1-one |
| InChIKey | NXGSXJMLDZJGIZ-BQYQJAHWSA-N |
| SMILES | C/C(=C\C(=O)C1=CC=CS1)/N(C)C |
Computed by PubChem (NCBI)