CAS 1127218-03-4 is the registry number for 2-(3-Methoxyphenyl)-4-methyl-5-(p-tolyl)thiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g.
2-(3-methoxyphenyl)-4-methyl-5-(4-methylphenyl)-1,3-thiazole (CAS 1127218-03-4) is a chemical compound with the molecular formula C18H17NOS and a molecular weight of 295.4 g/mol. IUPAC name: 2-(3-methoxyphenyl)-4-methyl-5-(4-methylphenyl)-1,3-thiazole. InChIKey: KDKAEQKYPVZDMW-UHFFFAOYSA-N.
| Molecular formula | C18H17NOS |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-4-methyl-5-(4-methylphenyl)-1,3-thiazole |
| InChIKey | KDKAEQKYPVZDMW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N=C(S2)C3=CC(=CC=C3)OC)C |
Computed by PubChem (NCBI)