CAS 112725-76-5 appears in our catalog under these names: 1H-Imidazol-3-ium tetrafluoroborate, 98%, Poly((9,9-dihexyl-9H -fluorene-2,7-vinylene)-co-(1-methoxy-4-(2-ethylhexyloxy)-2,5-phenylenevinylene)),(m:n=95:5 mole ratio), Imidazolium tetrafluoroborate, 98%, 98%. Offered by: Chemat Brand, Lumtec, Chemat. Available pack sizes: on request, 1g, 5g, 10g, 50g, 100g.
1H-imidazol-3-ium tetrafluoroborate (CAS 112725-76-5) is a chemical compound with the molecular formula C3H5BF4N2 and a molecular weight of 155.89 g/mol. IUPAC name: 1H-imidazol-3-ium tetrafluoroborate. InChIKey: JUOVGTNBPZKSCY-UHFFFAOYSA-O.
| Molecular formula | C3H5BF4N2 |
|---|---|
| Molecular weight | 155.89 g/mol |
| IUPAC name | 1H-imidazol-3-ium tetrafluoroborate |
| InChIKey | JUOVGTNBPZKSCY-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.C1=C[NH+]=CN1 |
Computed by PubChem (NCBI)