Products 112727-22-7
CAS 112727-22-7 is the registry number for Kelletinin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,4R)-2,3,4,5-tetrakis[(4-hydroxybenzoyl)oxy]pentyl] 4-hydroxybenzoate (CAS 112727-22-7) is a chemical compound with the molecular formula C40H32O15 and a molecular weight of 752.7 g/mol. IUPAC name: [(2S,4R)-2,3,4,5-tetrakis[(4-hydroxybenzoyl)oxy]pentyl] 4-hydroxybenzoate. InChIKey: VWTLXEPPPUFDHF-ZILSETFPSA-N.
| Molecular formula | C40H32O15 |
|---|---|
| Molecular weight | 752.7 g/mol |
| IUPAC name | [(2S,4R)-2,3,4,5-tetrakis[(4-hydroxybenzoyl)oxy]pentyl] 4-hydroxybenzoate |
| InChIKey | VWTLXEPPPUFDHF-ZILSETFPSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC[C@H](C([C@H](COC(=O)C2=CC=C(C=C2)O)OC(=O)C3=CC=C(C=C3)O)OC(=O)C4=CC=C(C=C4)O)OC(=O)C5=CC=C(C=C5)O)O |
Computed by PubChem (NCBI)