CAS 112748-45-5 is the registry number for 2,4-Dichloro-6-(3-fluorophenoxy)-1,3,5-triazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,4-dichloro-6-(3-fluorophenoxy)-1,3,5-triazine (CAS 112748-45-5) is a chemical compound with the molecular formula C9H4Cl2FN3O and a molecular weight of 260.05 g/mol. IUPAC name: 2,4-dichloro-6-(3-fluorophenoxy)-1,3,5-triazine. InChIKey: POKWKMCRFXFTIO-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2FN3O |
|---|---|
| Molecular weight | 260.05 g/mol |
| IUPAC name | 2,4-dichloro-6-(3-fluorophenoxy)-1,3,5-triazine |
| InChIKey | POKWKMCRFXFTIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=NC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)