CAS 112766-18-4 appears in our catalog under these names: Boc-L-Tyr(Tf)-OMe, 96%, Boc-L-Tyr(Tf)-OMe, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg.
Methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate (CAS 112766-18-4) is a chemical compound with the molecular formula C16H20F3NO7S and a molecular weight of 427.4 g/mol. IUPAC name: methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate. InChIKey: JZWGAKDJDOFGPF-LBPRGKRZSA-N.
| Molecular formula | C16H20F3NO7S |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-(trifluoromethylsulfonyloxy)phenyl]propanoate |
| InChIKey | JZWGAKDJDOFGPF-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)