CAS 112808-22-7 is the registry number for AD-5467. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]acetic acid (CAS 112808-22-7) is a chemical compound with the molecular formula C16H21NO3S and a molecular weight of 307.4 g/mol. IUPAC name: 2-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]acetic acid. InChIKey: CLDJCRWXLDLJLO-UHFFFAOYSA-N.
| Molecular formula | C16H21NO3S |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | 2-[2,8-di(propan-2-yl)-3-sulfanylidene-1,4-benzoxazin-4-yl]acetic acid |
| InChIKey | CLDJCRWXLDLJLO-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=S)N(C2=CC=CC(=C2O1)C(C)C)CC(=O)O |
Computed by PubChem (NCBI)