CAS 112811-70-8 appears in our catalog under these names: Moxifloxacin Impurity 54, Moxifloxacin Impurity Ⅷ, Moxifloxacin Impurity 19, 2-(2,4,5-Trifluoro-3-methoxybenzoyl)-3-cyclopropylaminoacrylic Acid Ethyl Ester. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
Ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,4,5-trifluoro-3-methoxyphenyl)prop-2-enoate (CAS 112811-70-8) is a chemical compound with the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. IUPAC name: ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,4,5-trifluoro-3-methoxyphenyl)prop-2-enoate. InChIKey: BDSKUVJINADHEK-UHFFFAOYSA-N.
| Molecular formula | C16H16F3NO4 |
|---|---|
| Molecular weight | 343.30 g/mol |
| IUPAC name | ethyl 2-(cyclopropyliminomethyl)-3-hydroxy-3-(2,4,5-trifluoro-3-methoxyphenyl)prop-2-enoate |
| InChIKey | BDSKUVJINADHEK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C(C1=CC(=C(C(=C1F)OC)F)F)O)C=NC2CC2 |
Computed by PubChem (NCBI)