Products 112856-39-0
CAS 112856-39-0 is the registry number for FR 78844. Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;[2-anilino-1-[hydroxy(oxido)phosphoryl]-2-sulfanylideneethyl]-hydroxyphosphinate (CAS 112856-39-0) is a chemical compound with the molecular formula C8H9NNa2O6P2S and a molecular weight of 355.15 g/mol. IUPAC name: disodium;[2-anilino-1-[hydroxy(oxido)phosphoryl]-2-sulfanylideneethyl]-hydroxyphosphinate. InChIKey: KTGBYROLTNECAS-UHFFFAOYSA-L.
| Molecular formula | C8H9NNa2O6P2S |
|---|---|
| Molecular weight | 355.15 g/mol |
| IUPAC name | disodium;[2-anilino-1-[hydroxy(oxido)phosphoryl]-2-sulfanylideneethyl]-hydroxyphosphinate |
| InChIKey | KTGBYROLTNECAS-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)NC(=S)C(P(=O)(O)[O-])P(=O)(O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)