CAS 112859-71-9 appears in our catalog under these names: Fluasterone, >95% (HPLC), Fluasterone, Fluasterone (Standard), Fluasterone, 99.85%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 25mg, Get quote, 50 mg, 100 mg, 10 mg.
(8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (CAS 112859-71-9) is a chemical compound with the molecular formula C19H27FO and a molecular weight of 290.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one. InChIKey: VHZXNQKVFDBFIK-NBBHSKLNSA-N.
| Molecular formula | C19H27FO |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S,16R)-16-fluoro-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | VHZXNQKVFDBFIK-NBBHSKLNSA-N |
| SMILES | C[C@]12CCCCC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3C[C@H](C4=O)F)C |
Computed by PubChem (NCBI)